About N-(1-cyanoethyl)-2,6-dimethylpyridine-3-carboxamide
N-(1-cyanoethyl)-2,6-dimethylpyridine-3-carboxamide (PubChem CID 55209186) has the molecular formula C11H13N3O
and a molecular weight of 203.24 g/mol. Its IUPAC name is N-(1-cyanoethyl)-2,6-dimethylpyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-(1-cyanoethyl)-2,6-dimethylpyridine-3-carboxamide |
| PubChem CID | 55209186 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | N-(1-cyanoethyl)-2,6-dimethylpyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)NC(C)C#N)c(C)n1 |
| InChI | InChI=1S/C11H13N3O/c1-7-4-5-10(9(3)13-7)11(15)14-8(2)6-12/h4-5,8H,1-3H3,(H,14,15) |
| InChIKey | FABUCIRPRBXWED-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1-cyanoethyl)-2,6-dimethylpyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-cyanoethyl)-2,6-dimethylpyridine-3-carboxamide?
The IUPAC name of N-(1-cyanoethyl)-2,6-dimethylpyridine-3-carboxamide (CID 55209186) is N-(1-cyanoethyl)-2,6-dimethylpyridine-3-carboxamide.
What is the SMILES notation for N-(1-cyanoethyl)-2,6-dimethylpyridine-3-carboxamide?
The canonical SMILES for N-(1-cyanoethyl)-2,6-dimethylpyridine-3-carboxamide is Cc1ccc(C(=O)NC(C)C#N)c(C)n1.
What is the InChIKey of N-(1-cyanoethyl)-2,6-dimethylpyridine-3-carboxamide?
The InChIKey is FABUCIRPRBXWED-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O/c1-7-4-5-10(9(3)13-7)11(15)14-8(2)6-12/h4-5,8H,1-3H3,(H,14,15).
What are the key properties of N-(1-cyanoethyl)-2,6-dimethylpyridine-3-carboxamide?
N-(1-cyanoethyl)-2,6-dimethylpyridine-3-carboxamide has a molecular weight of 203.24 g/mol, XLogP of 1.34, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyanoethyl)-2,6-dimethylpyridine-3-carboxamide is sourced from PubChem (CID 55209186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).