(2,4-dichlorophenyl)-[3-(2-hydroxyethyl)piperidin-1-yl]methanone

C14H17Cl2NO2 — CID 55209548

IUPAC(2,4-dichlorophenyl)-[3-(2-hydroxyethyl)piperidin-1-yl]methanone
SMILESO=C(c1ccc(Cl)cc1Cl)N1CCCC(CCO)C1
InChIInChI=1S/C14H17Cl2NO2/c15-11-3-4-12(13(16)8-11)14(19)17-6-1-2-10(9-17)5-7-18/h3-4,8,10,18H,1-2,5-7,9H2
InChIKeyVVNVTTUQAKYMQC-UHFFFAOYSA-N
MW302.20 g/mol
LogP3.23
Rot. Bonds3

About (2,4-dichlorophenyl)-[3-(2-hydroxyethyl)piperidin-1-yl]methanone

(2,4-dichlorophenyl)-[3-(2-hydroxyethyl)piperidin-1-yl]methanone (PubChem CID 55209548) has the molecular formula C14H17Cl2NO2 and a molecular weight of 302.20 g/mol. Its IUPAC name is (2,4-dichlorophenyl)-[3-(2-hydroxyethyl)piperidin-1-yl]methanone.

Molecular Properties

Compound Name(2,4-dichlorophenyl)-[3-(2-hydroxyethyl)piperidin-1-yl]methanone
PubChem CID55209548
Molecular FormulaC14H17Cl2NO2
Molecular Weight302.20 g/mol
Exact Mass301.06
IUPAC Name(2,4-dichlorophenyl)-[3-(2-hydroxyethyl)piperidin-1-yl]methanone
SMILESO=C(c1ccc(Cl)cc1Cl)N1CCCC(CCO)C1
InChIInChI=1S/C14H17Cl2NO2/c15-11-3-4-12(13(16)8-11)14(19)17-6-1-2-10(9-17)5-7-18/h3-4,8,10,18H,1-2,5-7,9H2
InChIKeyVVNVTTUQAKYMQC-UHFFFAOYSA-N
XLogP3.23
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500302.20
LogP ≤ 53.23
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze (2,4-dichlorophenyl)-[3-(2-hydroxyethyl)piperidin-1-yl]methanone with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2,5-dichlorophenyl)-[3-(2-hydroxyethyl)piperidin-1-yl]methanone
CID 62371472
(5-chloro-2-fluorophenyl)-[3-(2-hydroxyethyl)piperidin-1-yl]methanone
CID 62372699
(2-amino-5-chlorophenyl)-[3-(2-hydroxyethyl)piperidin-1-yl]methanone
CID 107209681
(2,4-dichlorophenyl)-[3-(hydroxymethyl)pyrrolidin-1-yl]methanone
CID 62348194
(3,5-dichlorophenyl)-[3-(2-hydroxyethyl)piperidin-1-yl]methanone
CID 62372685
(4-bromo-2-chlorophenyl)-[3-(2-bromoethyl)piperidin-1-yl]methanone
CID 80669190
(2-bromo-4-chlorophenyl)-[3-(2-chloroethyl)piperidin-1-yl]methanone
CID 107993644
(2,4-dimethylphenyl)-[3-(2-hydroxyethyl)piperidin-1-yl]methanone
CID 62373006
(4-amino-2-chlorophenyl)-[3-(hydroxymethyl)piperidin-1-yl]methanone
CID 43589993
(3-chloro-4-hydroxyphenyl)-[3-(2-hydroxyethyl)piperidin-1-yl]methanone
CID 62371633
[3-(2-bromoethyl)piperidin-1-yl]-(5-chloro-2-hydroxyphenyl)methanone
CID 80668613
(2-amino-5-chloro-4-pyridinyl)-[3-(2-hydroxyethyl)piperidin-1-yl]methanone
CID 107228718

Frequently Asked Questions

What is the IUPAC name of (2,4-dichlorophenyl)-[3-(2-hydroxyethyl)piperidin-1-yl]methanone?
The IUPAC name of (2,4-dichlorophenyl)-[3-(2-hydroxyethyl)piperidin-1-yl]methanone (CID 55209548) is (2,4-dichlorophenyl)-[3-(2-hydroxyethyl)piperidin-1-yl]methanone.
What is the SMILES notation for (2,4-dichlorophenyl)-[3-(2-hydroxyethyl)piperidin-1-yl]methanone?
The canonical SMILES for (2,4-dichlorophenyl)-[3-(2-hydroxyethyl)piperidin-1-yl]methanone is O=C(c1ccc(Cl)cc1Cl)N1CCCC(CCO)C1.
What is the InChIKey of (2,4-dichlorophenyl)-[3-(2-hydroxyethyl)piperidin-1-yl]methanone?
The InChIKey is VVNVTTUQAKYMQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17Cl2NO2/c15-11-3-4-12(13(16)8-11)14(19)17-6-1-2-10(9-17)5-7-18/h3-4,8,10,18H,1-2,5-7,9H2.
What are the key properties of (2,4-dichlorophenyl)-[3-(2-hydroxyethyl)piperidin-1-yl]methanone?
(2,4-dichlorophenyl)-[3-(2-hydroxyethyl)piperidin-1-yl]methanone has a molecular weight of 302.20 g/mol, XLogP of 3.23, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dichlorophenyl)-[3-(2-hydroxyethyl)piperidin-1-yl]methanone is sourced from PubChem (CID 55209548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).