C13H15F3N2 — CID 55210890
N-(2,4,5-trifluorophenyl)-1-azabicyclo[2.2.2]octan-3-amine (PubChem CID 55210890) has the molecular formula C13H15F3N2 and a molecular weight of 256.27 g/mol. Its IUPAC name is N-(2,4,5-trifluorophenyl)-1-azabicyclo[2.2.2]octan-3-amine.
| Compound Name | N-(2,4,5-trifluorophenyl)-1-azabicyclo[2.2.2]octan-3-amine |
|---|---|
| PubChem CID | 55210890 |
| Molecular Formula | C13H15F3N2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | N-(2,4,5-trifluorophenyl)-1-azabicyclo[2.2.2]octan-3-amine |
| SMILES | Fc1cc(F)c(NC2CN3CCC2CC3)cc1F |
| InChI | InChI=1S/C13H15F3N2/c14-9-5-11(16)12(6-10(9)15)17-13-7-18-3-1-8(13)2-4-18/h5-6,8,13,17H,1-4,7H2 |
| InChIKey | VGEIGIOODQGNPK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|