About 1-(1-ethoxyethoxy)butane
1-(1-ethoxyethoxy)butane (PubChem CID 552119) has the molecular formula C8H18O2
and a molecular weight of 146.23 g/mol. Its IUPAC name is 1-(1-ethoxyethoxy)butane.
Molecular Properties
| Compound Name | 1-(1-ethoxyethoxy)butane |
| PubChem CID | 552119 |
| Molecular Formula | C8H18O2 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.13 |
| IUPAC Name | 1-(1-ethoxyethoxy)butane |
| SMILES | CCCCOC(C)OCC |
| InChI | InChI=1S/C8H18O2/c1-4-6-7-10-8(3)9-5-2/h8H,4-7H2,1-3H3 |
| InChIKey | VULXTAWRXFGMKL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-ethoxyethoxy)butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-ethoxyethoxy)butane?
The IUPAC name of 1-(1-ethoxyethoxy)butane (CID 552119) is 1-(1-ethoxyethoxy)butane.
What is the SMILES notation for 1-(1-ethoxyethoxy)butane?
The canonical SMILES for 1-(1-ethoxyethoxy)butane is CCCCOC(C)OCC.
What is the InChIKey of 1-(1-ethoxyethoxy)butane?
The InChIKey is VULXTAWRXFGMKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O2/c1-4-6-7-10-8(3)9-5-2/h8H,4-7H2,1-3H3.
What are the key properties of 1-(1-ethoxyethoxy)butane?
1-(1-ethoxyethoxy)butane has a molecular weight of 146.23 g/mol, XLogP of 2.19, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-ethoxyethoxy)butane is sourced from PubChem (CID 552119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).