About 4-amino-1H-pyrrolo[3,2-c]pyridine-2-carbaldehyde
4-amino-1H-pyrrolo[3,2-c]pyridine-2-carbaldehyde (PubChem CID 55212084) has the molecular formula C8H7N3O
and a molecular weight of 161.16 g/mol. Its IUPAC name is 4-amino-1H-pyrrolo[3,2-c]pyridine-2-carbaldehyde.
Molecular Properties
| Compound Name | 4-amino-1H-pyrrolo[3,2-c]pyridine-2-carbaldehyde |
| PubChem CID | 55212084 |
| Molecular Formula | C8H7N3O |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | 4-amino-1H-pyrrolo[3,2-c]pyridine-2-carbaldehyde |
| SMILES | Nc1nccc2[nH]c(C=O)cc12 |
| InChI | InChI=1S/C8H7N3O/c9-8-6-3-5(4-12)11-7(6)1-2-10-8/h1-4,11H,(H2,9,10) |
| InChIKey | YTJSCLQGTFKMGJ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-1H-pyrrolo[3,2-c]pyridine-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1H-pyrrolo[3,2-c]pyridine-2-carbaldehyde?
The IUPAC name of 4-amino-1H-pyrrolo[3,2-c]pyridine-2-carbaldehyde (CID 55212084) is 4-amino-1H-pyrrolo[3,2-c]pyridine-2-carbaldehyde.
What is the SMILES notation for 4-amino-1H-pyrrolo[3,2-c]pyridine-2-carbaldehyde?
The canonical SMILES for 4-amino-1H-pyrrolo[3,2-c]pyridine-2-carbaldehyde is Nc1nccc2[nH]c(C=O)cc12.
What is the InChIKey of 4-amino-1H-pyrrolo[3,2-c]pyridine-2-carbaldehyde?
The InChIKey is YTJSCLQGTFKMGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O/c9-8-6-3-5(4-12)11-7(6)1-2-10-8/h1-4,11H,(H2,9,10).
What are the key properties of 4-amino-1H-pyrrolo[3,2-c]pyridine-2-carbaldehyde?
4-amino-1H-pyrrolo[3,2-c]pyridine-2-carbaldehyde has a molecular weight of 161.16 g/mol, XLogP of 0.96, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1H-pyrrolo[3,2-c]pyridine-2-carbaldehyde is sourced from PubChem (CID 55212084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).