About 4-(1,3-dioxolan-2-yl)-3,4-dimethylcyclohex-2-en-1-one
4-(1,3-dioxolan-2-yl)-3,4-dimethylcyclohex-2-en-1-one (PubChem CID 552123) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is 4-(1,3-dioxolan-2-yl)-3,4-dimethylcyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 4-(1,3-dioxolan-2-yl)-3,4-dimethylcyclohex-2-en-1-one |
| PubChem CID | 552123 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 4-(1,3-dioxolan-2-yl)-3,4-dimethylcyclohex-2-en-1-one |
| SMILES | CC1=CC(=O)CCC1(C)C1OCCO1 |
| InChI | InChI=1S/C11H16O3/c1-8-7-9(12)3-4-11(8,2)10-13-5-6-14-10/h7,10H,3-6H2,1-2H3 |
| InChIKey | VRMKWKXBLAKJNX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(1,3-dioxolan-2-yl)-3,4-dimethylcyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-dioxolan-2-yl)-3,4-dimethylcyclohex-2-en-1-one?
The IUPAC name of 4-(1,3-dioxolan-2-yl)-3,4-dimethylcyclohex-2-en-1-one (CID 552123) is 4-(1,3-dioxolan-2-yl)-3,4-dimethylcyclohex-2-en-1-one.
What is the SMILES notation for 4-(1,3-dioxolan-2-yl)-3,4-dimethylcyclohex-2-en-1-one?
The canonical SMILES for 4-(1,3-dioxolan-2-yl)-3,4-dimethylcyclohex-2-en-1-one is CC1=CC(=O)CCC1(C)C1OCCO1.
What is the InChIKey of 4-(1,3-dioxolan-2-yl)-3,4-dimethylcyclohex-2-en-1-one?
The InChIKey is VRMKWKXBLAKJNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c1-8-7-9(12)3-4-11(8,2)10-13-5-6-14-10/h7,10H,3-6H2,1-2H3.
What are the key properties of 4-(1,3-dioxolan-2-yl)-3,4-dimethylcyclohex-2-en-1-one?
4-(1,3-dioxolan-2-yl)-3,4-dimethylcyclohex-2-en-1-one has a molecular weight of 196.25 g/mol, XLogP of 1.67, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-dioxolan-2-yl)-3,4-dimethylcyclohex-2-en-1-one is sourced from PubChem (CID 552123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).