C11H16F3N3OS — CID 55212678
5-[[propyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carbohydrazide (PubChem CID 55212678) has the molecular formula C11H16F3N3OS and a molecular weight of 295.33 g/mol. Its IUPAC name is 5-[[propyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carbohydrazide.
| Compound Name | 5-[[propyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 55212678 |
| Molecular Formula | C11H16F3N3OS |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 5-[[propyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carbohydrazide |
| SMILES | CCCN(Cc1ccc(C(=O)NN)s1)CC(F)(F)F |
| InChI | InChI=1S/C11H16F3N3OS/c1-2-5-17(7-11(12,13)14)6-8-3-4-9(19-8)10(18)16-15/h3-4H,2,5-7,15H2,1H3,(H,16,18) |
| InChIKey | WMJKGYCFCJOCJR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|