About N-(1H-imidazol-2-yl)-4,6-dimethyl-2-oxo-1H-pyridine-3-carboxamide
N-(1H-imidazol-2-yl)-4,6-dimethyl-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 55212766) has the molecular formula C11H12N4O2
and a molecular weight of 232.24 g/mol. Its IUPAC name is N-(1H-imidazol-2-yl)-4,6-dimethyl-2-oxo-1H-pyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-(1H-imidazol-2-yl)-4,6-dimethyl-2-oxo-1H-pyridine-3-carboxamide |
| PubChem CID | 55212766 |
| Molecular Formula | C11H12N4O2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | N-(1H-imidazol-2-yl)-4,6-dimethyl-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | Cc1cc(C)c(C(=O)Nc2ncc[nH]2)c(=O)[nH]1 |
| InChI | InChI=1S/C11H12N4O2/c1-6-5-7(2)14-9(16)8(6)10(17)15-11-12-3-4-13-11/h3-5H,1-2H3,(H,14,16)(H2,12,13,15,17) |
| InChIKey | KFAVPGRFOBUUDL-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1H-imidazol-2-yl)-4,6-dimethyl-2-oxo-1H-pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1H-imidazol-2-yl)-4,6-dimethyl-2-oxo-1H-pyridine-3-carboxamide?
The IUPAC name of N-(1H-imidazol-2-yl)-4,6-dimethyl-2-oxo-1H-pyridine-3-carboxamide (CID 55212766) is N-(1H-imidazol-2-yl)-4,6-dimethyl-2-oxo-1H-pyridine-3-carboxamide.
What is the SMILES notation for N-(1H-imidazol-2-yl)-4,6-dimethyl-2-oxo-1H-pyridine-3-carboxamide?
The canonical SMILES for N-(1H-imidazol-2-yl)-4,6-dimethyl-2-oxo-1H-pyridine-3-carboxamide is Cc1cc(C)c(C(=O)Nc2ncc[nH]2)c(=O)[nH]1.
What is the InChIKey of N-(1H-imidazol-2-yl)-4,6-dimethyl-2-oxo-1H-pyridine-3-carboxamide?
The InChIKey is KFAVPGRFOBUUDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4O2/c1-6-5-7(2)14-9(16)8(6)10(17)15-11-12-3-4-13-11/h3-5H,1-2H3,(H,14,16)(H2,12,13,15,17).
What are the key properties of N-(1H-imidazol-2-yl)-4,6-dimethyl-2-oxo-1H-pyridine-3-carboxamide?
N-(1H-imidazol-2-yl)-4,6-dimethyl-2-oxo-1H-pyridine-3-carboxamide has a molecular weight of 232.24 g/mol, XLogP of 0.97, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1H-imidazol-2-yl)-4,6-dimethyl-2-oxo-1H-pyridine-3-carboxamide is sourced from PubChem (CID 55212766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).