C10H12N4O2S2 — CID 55213098
4-[(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)methyl]-1,3-thiazole-2-carbohydrazide (PubChem CID 55213098) has the molecular formula C10H12N4O2S2 and a molecular weight of 284.37 g/mol. Its IUPAC name is 4-[(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)methyl]-1,3-thiazole-2-carbohydrazide.
| Compound Name | 4-[(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)methyl]-1,3-thiazole-2-carbohydrazide |
|---|---|
| PubChem CID | 55213098 |
| Molecular Formula | C10H12N4O2S2 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 4-[(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)methyl]-1,3-thiazole-2-carbohydrazide |
| SMILES | Cc1sc(=O)n(Cc2csc(C(=O)NN)n2)c1C |
| InChI | InChI=1S/C10H12N4O2S2/c1-5-6(2)18-10(16)14(5)3-7-4-17-9(12-7)8(15)13-11/h4H,3,11H2,1-2H3,(H,13,15) |
| InChIKey | AYIYRXPCRHHWGR-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|