C12H14N2O3 — CID 55213785
2-(ethoxymethyl)-1-benzofuran-3-carbohydrazide (PubChem CID 55213785) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 2-(ethoxymethyl)-1-benzofuran-3-carbohydrazide.
| Compound Name | 2-(ethoxymethyl)-1-benzofuran-3-carbohydrazide |
|---|---|
| PubChem CID | 55213785 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 2-(ethoxymethyl)-1-benzofuran-3-carbohydrazide |
| SMILES | CCOCc1oc2ccccc2c1C(=O)NN |
| InChI | InChI=1S/C12H14N2O3/c1-2-16-7-10-11(12(15)14-13)8-5-3-4-6-9(8)17-10/h3-6H,2,7,13H2,1H3,(H,14,15) |
| InChIKey | KUQWJVRBCAGHBN-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|