C12H26N4O2 — CID 55214049
2-[ethyl-(5-hydrazinyl-5-oxopentan-2-yl)amino]-N-propan-2-ylacetamide (PubChem CID 55214049) has the molecular formula C12H26N4O2 and a molecular weight of 258.37 g/mol. Its IUPAC name is 2-[ethyl-(5-hydrazinyl-5-oxopentan-2-yl)amino]-N-propan-2-ylacetamide.
| Compound Name | 2-[ethyl-(5-hydrazinyl-5-oxopentan-2-yl)amino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 55214049 |
| Molecular Formula | C12H26N4O2 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 2-[ethyl-(5-hydrazinyl-5-oxopentan-2-yl)amino]-N-propan-2-ylacetamide |
| SMILES | CCN(CC(=O)NC(C)C)C(C)CCC(=O)NN |
| InChI | InChI=1S/C12H26N4O2/c1-5-16(8-12(18)14-9(2)3)10(4)6-7-11(17)15-13/h9-10H,5-8,13H2,1-4H3,(H,14,18)(H,15,17) |
| InChIKey | MRWZPURUZPPJBY-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|