About 4-(6-chloro-2-pyridinyl)-3,5-dihydro-2H-1,4-benzoxazepine
4-(6-chloro-2-pyridinyl)-3,5-dihydro-2H-1,4-benzoxazepine (PubChem CID 55214156) has the molecular formula C14H13ClN2O
and a molecular weight of 260.72 g/mol. Its IUPAC name is 4-(6-chloro-2-pyridinyl)-3,5-dihydro-2H-1,4-benzoxazepine.
Molecular Properties
| Compound Name | 4-(6-chloro-2-pyridinyl)-3,5-dihydro-2H-1,4-benzoxazepine |
| PubChem CID | 55214156 |
| Molecular Formula | C14H13ClN2O |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 4-(6-chloro-2-pyridinyl)-3,5-dihydro-2H-1,4-benzoxazepine |
| SMILES | Clc1cccc(N2CCOc3ccccc3C2)n1 |
| InChI | InChI=1S/C14H13ClN2O/c15-13-6-3-7-14(16-13)17-8-9-18-12-5-2-1-4-11(12)10-17/h1-7H,8-10H2 |
| InChIKey | OZIDDUXJFVWHTH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-(6-chloro-2-pyridinyl)-3,5-dihydro-2H-1,4-benzoxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-chloro-2-pyridinyl)-3,5-dihydro-2H-1,4-benzoxazepine?
The IUPAC name of 4-(6-chloro-2-pyridinyl)-3,5-dihydro-2H-1,4-benzoxazepine (CID 55214156) is 4-(6-chloro-2-pyridinyl)-3,5-dihydro-2H-1,4-benzoxazepine.
What is the SMILES notation for 4-(6-chloro-2-pyridinyl)-3,5-dihydro-2H-1,4-benzoxazepine?
The canonical SMILES for 4-(6-chloro-2-pyridinyl)-3,5-dihydro-2H-1,4-benzoxazepine is Clc1cccc(N2CCOc3ccccc3C2)n1.
What is the InChIKey of 4-(6-chloro-2-pyridinyl)-3,5-dihydro-2H-1,4-benzoxazepine?
The InChIKey is OZIDDUXJFVWHTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13ClN2O/c15-13-6-3-7-14(16-13)17-8-9-18-12-5-2-1-4-11(12)10-17/h1-7H,8-10H2.
What are the key properties of 4-(6-chloro-2-pyridinyl)-3,5-dihydro-2H-1,4-benzoxazepine?
4-(6-chloro-2-pyridinyl)-3,5-dihydro-2H-1,4-benzoxazepine has a molecular weight of 260.72 g/mol, XLogP of 3.13, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-chloro-2-pyridinyl)-3,5-dihydro-2H-1,4-benzoxazepine is sourced from PubChem (CID 55214156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).