C21H27N3O2Si — CID 552143
8,11,11-trimethyl-4-phenyl-9-trimethylsilyl-2,4,6-triazatetracyclo[5.5.0.02,6.08,12]dodec-9-ene-3,5-dione (PubChem CID 552143) has the molecular formula C21H27N3O2Si and a molecular weight of 381.55 g/mol. Its IUPAC name is 8,11,11-trimethyl-4-phenyl-9-trimethylsilyl-2,4,6-triazatetracyclo[5.5.0.02,6.08,12]dodec-9-ene-3,5-dione.
| Compound Name | 8,11,11-trimethyl-4-phenyl-9-trimethylsilyl-2,4,6-triazatetracyclo[5.5.0.02,6.08,12]dodec-9-ene-3,5-dione |
|---|---|
| PubChem CID | 552143 |
| Molecular Formula | C21H27N3O2Si |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 8,11,11-trimethyl-4-phenyl-9-trimethylsilyl-2,4,6-triazatetracyclo[5.5.0.02,6.08,12]dodec-9-ene-3,5-dione |
| SMILES | CC1(C)C=C([Si](C)(C)C)C2(C)C3C(C12)n1c(=O)n(-c2ccccc2)c(=O)n13 |
| InChI | InChI=1S/C21H27N3O2Si/c1-20(2)12-14(27(4,5)6)21(3)16(20)15-17(21)24-19(26)22(18(25)23(15)24)13-10-8-7-9-11-13/h7-12,15-17H,1-6H3 |
| InChIKey | SGJUPSSSXMCVPO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|