About 3-[(3,5-difluorophenoxy)methyl]furan-2-carbohydrazide
3-[(3,5-difluorophenoxy)methyl]furan-2-carbohydrazide (PubChem CID 55214971) has the molecular formula C12H10F2N2O3
and a molecular weight of 268.22 g/mol. Its IUPAC name is 3-[(3,5-difluorophenoxy)methyl]furan-2-carbohydrazide.
Molecular Properties
| Compound Name | 3-[(3,5-difluorophenoxy)methyl]furan-2-carbohydrazide |
| PubChem CID | 55214971 |
| Molecular Formula | C12H10F2N2O3 |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 3-[(3,5-difluorophenoxy)methyl]furan-2-carbohydrazide |
| SMILES | NNC(=O)c1occc1COc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H10F2N2O3/c13-8-3-9(14)5-10(4-8)19-6-7-1-2-18-11(7)12(17)16-15/h1-5H,6,15H2,(H,16,17) |
| InChIKey | GOEBQZQAABBSQQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3,5-difluorophenoxy)methyl]furan-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,5-difluorophenoxy)methyl]furan-2-carbohydrazide?
The IUPAC name of 3-[(3,5-difluorophenoxy)methyl]furan-2-carbohydrazide (CID 55214971) is 3-[(3,5-difluorophenoxy)methyl]furan-2-carbohydrazide.
What is the SMILES notation for 3-[(3,5-difluorophenoxy)methyl]furan-2-carbohydrazide?
The canonical SMILES for 3-[(3,5-difluorophenoxy)methyl]furan-2-carbohydrazide is NNC(=O)c1occc1COc1cc(F)cc(F)c1.
What is the InChIKey of 3-[(3,5-difluorophenoxy)methyl]furan-2-carbohydrazide?
The InChIKey is GOEBQZQAABBSQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F2N2O3/c13-8-3-9(14)5-10(4-8)19-6-7-1-2-18-11(7)12(17)16-15/h1-5H,6,15H2,(H,16,17).
What are the key properties of 3-[(3,5-difluorophenoxy)methyl]furan-2-carbohydrazide?
3-[(3,5-difluorophenoxy)methyl]furan-2-carbohydrazide has a molecular weight of 268.22 g/mol, XLogP of 1.74, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,5-difluorophenoxy)methyl]furan-2-carbohydrazide is sourced from PubChem (CID 55214971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).