C14H20N4 — CID 55215132
3-N-cinnolin-4-yl-1-N,1-N-dimethylbutane-1,3-diamine (PubChem CID 55215132) has the molecular formula C14H20N4 and a molecular weight of 244.34 g/mol. Its IUPAC name is 3-N-cinnolin-4-yl-1-N,1-N-dimethylbutane-1,3-diamine.
| Compound Name | 3-N-cinnolin-4-yl-1-N,1-N-dimethylbutane-1,3-diamine |
|---|---|
| PubChem CID | 55215132 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 3-N-cinnolin-4-yl-1-N,1-N-dimethylbutane-1,3-diamine |
| SMILES | CC(CCN(C)C)Nc1cnnc2ccccc12 |
| InChI | InChI=1S/C14H20N4/c1-11(8-9-18(2)3)16-14-10-15-17-13-7-5-4-6-12(13)14/h4-7,10-11H,8-9H2,1-3H3,(H,16,17) |
| InChIKey | OCWAVFHXDNIQLY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |