C10H14F3N3OS — CID 55215206
5-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carbohydrazide (PubChem CID 55215206) has the molecular formula C10H14F3N3OS and a molecular weight of 281.30 g/mol. Its IUPAC name is 5-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carbohydrazide.
| Compound Name | 5-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 55215206 |
| Molecular Formula | C10H14F3N3OS |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 5-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carbohydrazide |
| SMILES | CCN(Cc1ccc(C(=O)NN)s1)CC(F)(F)F |
| InChI | InChI=1S/C10H14F3N3OS/c1-2-16(6-10(11,12)13)5-7-3-4-8(18-7)9(17)15-14/h3-4H,2,5-6,14H2,1H3,(H,15,17) |
| InChIKey | YAWYFMXNOOGZGX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|