About (1R)-1-[3-fluoro-4-(3,3,4-trimethylpiperazin-1-yl)phenyl]ethanamine
(1R)-1-[3-fluoro-4-(3,3,4-trimethylpiperazin-1-yl)phenyl]ethanamine (PubChem CID 55216383) has the molecular formula C15H24FN3
and a molecular weight of 265.38 g/mol. Its IUPAC name is (1R)-1-[3-fluoro-4-(3,3,4-trimethylpiperazin-1-yl)phenyl]ethanamine.
Molecular Properties
| Compound Name | (1R)-1-[3-fluoro-4-(3,3,4-trimethylpiperazin-1-yl)phenyl]ethanamine |
| PubChem CID | 55216383 |
| Molecular Formula | C15H24FN3 |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | (1R)-1-[3-fluoro-4-(3,3,4-trimethylpiperazin-1-yl)phenyl]ethanamine |
| SMILES | C[C@@H](N)c1ccc(N2CCN(C)C(C)(C)C2)c(F)c1 |
| InChI | InChI=1S/C15H24FN3/c1-11(17)12-5-6-14(13(16)9-12)19-8-7-18(4)15(2,3)10-19/h5-6,9,11H,7-8,10,17H2,1-4H3/t11-/m1/s1 |
| InChIKey | ALNMUMDKBQOGHI-LLVKDONJSA-N |
| XLogP | 2.38 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R)-1-[3-fluoro-4-(3,3,4-trimethylpiperazin-1-yl)phenyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-[3-fluoro-4-(3,3,4-trimethylpiperazin-1-yl)phenyl]ethanamine?
The IUPAC name of (1R)-1-[3-fluoro-4-(3,3,4-trimethylpiperazin-1-yl)phenyl]ethanamine (CID 55216383) is (1R)-1-[3-fluoro-4-(3,3,4-trimethylpiperazin-1-yl)phenyl]ethanamine.
What is the SMILES notation for (1R)-1-[3-fluoro-4-(3,3,4-trimethylpiperazin-1-yl)phenyl]ethanamine?
The canonical SMILES for (1R)-1-[3-fluoro-4-(3,3,4-trimethylpiperazin-1-yl)phenyl]ethanamine is C[C@@H](N)c1ccc(N2CCN(C)C(C)(C)C2)c(F)c1.
What is the InChIKey of (1R)-1-[3-fluoro-4-(3,3,4-trimethylpiperazin-1-yl)phenyl]ethanamine?
The InChIKey is ALNMUMDKBQOGHI-LLVKDONJSA-N. The full InChI is InChI=1S/C15H24FN3/c1-11(17)12-5-6-14(13(16)9-12)19-8-7-18(4)15(2,3)10-19/h5-6,9,11H,7-8,10,17H2,1-4H3/t11-/m1/s1.
What are the key properties of (1R)-1-[3-fluoro-4-(3,3,4-trimethylpiperazin-1-yl)phenyl]ethanamine?
(1R)-1-[3-fluoro-4-(3,3,4-trimethylpiperazin-1-yl)phenyl]ethanamine has a molecular weight of 265.38 g/mol, XLogP of 2.38, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-[3-fluoro-4-(3,3,4-trimethylpiperazin-1-yl)phenyl]ethanamine is sourced from PubChem (CID 55216383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).