About 4-[(5-chlorothiophen-2-yl)methoxy]-2,5-difluoroaniline
4-[(5-chlorothiophen-2-yl)methoxy]-2,5-difluoroaniline (PubChem CID 55217609) has the molecular formula C11H8ClF2NOS
and a molecular weight of 275.71 g/mol. Its IUPAC name is 4-[(5-chlorothiophen-2-yl)methoxy]-2,5-difluoroaniline.
Molecular Properties
| Compound Name | 4-[(5-chlorothiophen-2-yl)methoxy]-2,5-difluoroaniline |
| PubChem CID | 55217609 |
| Molecular Formula | C11H8ClF2NOS |
| Molecular Weight | 275.71 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | 4-[(5-chlorothiophen-2-yl)methoxy]-2,5-difluoroaniline |
| SMILES | Nc1cc(F)c(OCc2ccc(Cl)s2)cc1F |
| InChI | InChI=1S/C11H8ClF2NOS/c12-11-2-1-6(17-11)5-16-10-4-7(13)9(15)3-8(10)14/h1-4H,5,15H2 |
| InChIKey | KTZGYCAYPCNOBS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.71 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[(5-chlorothiophen-2-yl)methoxy]-2,5-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-chlorothiophen-2-yl)methoxy]-2,5-difluoroaniline?
The IUPAC name of 4-[(5-chlorothiophen-2-yl)methoxy]-2,5-difluoroaniline (CID 55217609) is 4-[(5-chlorothiophen-2-yl)methoxy]-2,5-difluoroaniline.
What is the SMILES notation for 4-[(5-chlorothiophen-2-yl)methoxy]-2,5-difluoroaniline?
The canonical SMILES for 4-[(5-chlorothiophen-2-yl)methoxy]-2,5-difluoroaniline is Nc1cc(F)c(OCc2ccc(Cl)s2)cc1F.
What is the InChIKey of 4-[(5-chlorothiophen-2-yl)methoxy]-2,5-difluoroaniline?
The InChIKey is KTZGYCAYPCNOBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClF2NOS/c12-11-2-1-6(17-11)5-16-10-4-7(13)9(15)3-8(10)14/h1-4H,5,15H2.
What are the key properties of 4-[(5-chlorothiophen-2-yl)methoxy]-2,5-difluoroaniline?
4-[(5-chlorothiophen-2-yl)methoxy]-2,5-difluoroaniline has a molecular weight of 275.71 g/mol, XLogP of 3.84, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-chlorothiophen-2-yl)methoxy]-2,5-difluoroaniline is sourced from PubChem (CID 55217609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).