C11H13FN4OS — CID 55217625
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-5-fluoro-4-methoxyaniline (PubChem CID 55217625) has the molecular formula C11H13FN4OS and a molecular weight of 268.32 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-5-fluoro-4-methoxyaniline.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-5-fluoro-4-methoxyaniline |
|---|---|
| PubChem CID | 55217625 |
| Molecular Formula | C11H13FN4OS |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-5-fluoro-4-methoxyaniline |
| SMILES | COc1cc(Sc2nnc(C)n2C)c(N)cc1F |
| InChI | InChI=1S/C11H13FN4OS/c1-6-14-15-11(16(6)2)18-10-5-9(17-3)7(12)4-8(10)13/h4-5H,13H2,1-3H3 |
| InChIKey | USNGMMKKBIXQLC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|