About 3-(chloromethyl)-2-(3,4-dimethylpiperazin-1-yl)imidazo[1,2-a]pyridine
3-(chloromethyl)-2-(3,4-dimethylpiperazin-1-yl)imidazo[1,2-a]pyridine (PubChem CID 55217934) has the molecular formula C14H19ClN4
and a molecular weight of 278.79 g/mol. Its IUPAC name is 3-(chloromethyl)-2-(3,4-dimethylpiperazin-1-yl)imidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 3-(chloromethyl)-2-(3,4-dimethylpiperazin-1-yl)imidazo[1,2-a]pyridine |
| PubChem CID | 55217934 |
| Molecular Formula | C14H19ClN4 |
| Molecular Weight | 278.79 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 3-(chloromethyl)-2-(3,4-dimethylpiperazin-1-yl)imidazo[1,2-a]pyridine |
| SMILES | CC1CN(c2nc3ccccn3c2CCl)CCN1C |
| InChI | InChI=1S/C14H19ClN4/c1-11-10-18(8-7-17(11)2)14-12(9-15)19-6-4-3-5-13(19)16-14/h3-6,11H,7-10H2,1-2H3 |
| InChIKey | SJHYJQUCSIOSID-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 23.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.79 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(chloromethyl)-2-(3,4-dimethylpiperazin-1-yl)imidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(chloromethyl)-2-(3,4-dimethylpiperazin-1-yl)imidazo[1,2-a]pyridine?
The IUPAC name of 3-(chloromethyl)-2-(3,4-dimethylpiperazin-1-yl)imidazo[1,2-a]pyridine (CID 55217934) is 3-(chloromethyl)-2-(3,4-dimethylpiperazin-1-yl)imidazo[1,2-a]pyridine.
What is the SMILES notation for 3-(chloromethyl)-2-(3,4-dimethylpiperazin-1-yl)imidazo[1,2-a]pyridine?
The canonical SMILES for 3-(chloromethyl)-2-(3,4-dimethylpiperazin-1-yl)imidazo[1,2-a]pyridine is CC1CN(c2nc3ccccn3c2CCl)CCN1C.
What is the InChIKey of 3-(chloromethyl)-2-(3,4-dimethylpiperazin-1-yl)imidazo[1,2-a]pyridine?
The InChIKey is SJHYJQUCSIOSID-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19ClN4/c1-11-10-18(8-7-17(11)2)14-12(9-15)19-6-4-3-5-13(19)16-14/h3-6,11H,7-10H2,1-2H3.
What are the key properties of 3-(chloromethyl)-2-(3,4-dimethylpiperazin-1-yl)imidazo[1,2-a]pyridine?
3-(chloromethyl)-2-(3,4-dimethylpiperazin-1-yl)imidazo[1,2-a]pyridine has a molecular weight of 278.79 g/mol, XLogP of 2.21, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(chloromethyl)-2-(3,4-dimethylpiperazin-1-yl)imidazo[1,2-a]pyridine is sourced from PubChem (CID 55217934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).