C11H16N2O2S — CID 55218707
N-methyl-N-(oxan-2-ylmethyl)-1,3-thiazole-4-carboxamide (PubChem CID 55218707) has the molecular formula C11H16N2O2S and a molecular weight of 240.33 g/mol. Its IUPAC name is N-methyl-N-(oxan-2-ylmethyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-methyl-N-(oxan-2-ylmethyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 55218707 |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | N-methyl-N-(oxan-2-ylmethyl)-1,3-thiazole-4-carboxamide |
| SMILES | CN(CC1CCCCO1)C(=O)c1cscn1 |
| InChI | InChI=1S/C11H16N2O2S/c1-13(6-9-4-2-3-5-15-9)11(14)10-7-16-8-12-10/h7-9H,2-6H2,1H3 |
| InChIKey | AVDMCDZQDXYRNB-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |