About 3-(4,4-diethylpiperidin-1-yl)pentanenitrile
3-(4,4-diethylpiperidin-1-yl)pentanenitrile (PubChem CID 55218860) has the molecular formula C14H26N2
and a molecular weight of 222.38 g/mol. Its IUPAC name is 3-(4,4-diethylpiperidin-1-yl)pentanenitrile.
Molecular Properties
| Compound Name | 3-(4,4-diethylpiperidin-1-yl)pentanenitrile |
| PubChem CID | 55218860 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 3-(4,4-diethylpiperidin-1-yl)pentanenitrile |
| SMILES | CCC(CC#N)N1CCC(CC)(CC)CC1 |
| InChI | InChI=1S/C14H26N2/c1-4-13(7-10-15)16-11-8-14(5-2,6-3)9-12-16/h13H,4-9,11-12H2,1-3H3 |
| InChIKey | XPZFIILJXNIPSD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4,4-diethylpiperidin-1-yl)pentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,4-diethylpiperidin-1-yl)pentanenitrile?
The IUPAC name of 3-(4,4-diethylpiperidin-1-yl)pentanenitrile (CID 55218860) is 3-(4,4-diethylpiperidin-1-yl)pentanenitrile.
What is the SMILES notation for 3-(4,4-diethylpiperidin-1-yl)pentanenitrile?
The canonical SMILES for 3-(4,4-diethylpiperidin-1-yl)pentanenitrile is CCC(CC#N)N1CCC(CC)(CC)CC1.
What is the InChIKey of 3-(4,4-diethylpiperidin-1-yl)pentanenitrile?
The InChIKey is XPZFIILJXNIPSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2/c1-4-13(7-10-15)16-11-8-14(5-2,6-3)9-12-16/h13H,4-9,11-12H2,1-3H3.
What are the key properties of 3-(4,4-diethylpiperidin-1-yl)pentanenitrile?
3-(4,4-diethylpiperidin-1-yl)pentanenitrile has a molecular weight of 222.38 g/mol, XLogP of 3.58, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,4-diethylpiperidin-1-yl)pentanenitrile is sourced from PubChem (CID 55218860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).