About 2-[4-(2,2-difluoroethyl)piperazin-1-yl]butanenitrile
2-[4-(2,2-difluoroethyl)piperazin-1-yl]butanenitrile (PubChem CID 55219345) has the molecular formula C10H17F2N3
and a molecular weight of 217.26 g/mol. Its IUPAC name is 2-[4-(2,2-difluoroethyl)piperazin-1-yl]butanenitrile.
Molecular Properties
| Compound Name | 2-[4-(2,2-difluoroethyl)piperazin-1-yl]butanenitrile |
| PubChem CID | 55219345 |
| Molecular Formula | C10H17F2N3 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.14 |
| IUPAC Name | 2-[4-(2,2-difluoroethyl)piperazin-1-yl]butanenitrile |
| SMILES | CCC(C#N)N1CCN(CC(F)F)CC1 |
| InChI | InChI=1S/C10H17F2N3/c1-2-9(7-13)15-5-3-14(4-6-15)8-10(11)12/h9-10H,2-6,8H2,1H3 |
| InChIKey | LLLLSPIZUMBOSJ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-(2,2-difluoroethyl)piperazin-1-yl]butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2,2-difluoroethyl)piperazin-1-yl]butanenitrile?
The IUPAC name of 2-[4-(2,2-difluoroethyl)piperazin-1-yl]butanenitrile (CID 55219345) is 2-[4-(2,2-difluoroethyl)piperazin-1-yl]butanenitrile.
What is the SMILES notation for 2-[4-(2,2-difluoroethyl)piperazin-1-yl]butanenitrile?
The canonical SMILES for 2-[4-(2,2-difluoroethyl)piperazin-1-yl]butanenitrile is CCC(C#N)N1CCN(CC(F)F)CC1.
What is the InChIKey of 2-[4-(2,2-difluoroethyl)piperazin-1-yl]butanenitrile?
The InChIKey is LLLLSPIZUMBOSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F2N3/c1-2-9(7-13)15-5-3-14(4-6-15)8-10(11)12/h9-10H,2-6,8H2,1H3.
What are the key properties of 2-[4-(2,2-difluoroethyl)piperazin-1-yl]butanenitrile?
2-[4-(2,2-difluoroethyl)piperazin-1-yl]butanenitrile has a molecular weight of 217.26 g/mol, XLogP of 1.17, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2,2-difluoroethyl)piperazin-1-yl]butanenitrile is sourced from PubChem (CID 55219345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).