About 3-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)propanamide
3-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)propanamide (PubChem CID 55219479) has the molecular formula C9H13N3O3
and a molecular weight of 211.22 g/mol. Its IUPAC name is 3-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)propanamide.
Molecular Properties
| Compound Name | 3-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)propanamide |
| PubChem CID | 55219479 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 3-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)propanamide |
| SMILES | Cc1c(C)c(=O)n(CCC(N)=O)[nH]c1=O |
| InChI | InChI=1S/C9H13N3O3/c1-5-6(2)9(15)12(11-8(5)14)4-3-7(10)13/h3-4H2,1-2H3,(H2,10,13)(H,11,14) |
| InChIKey | AHAZUFXRUPXBIA-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 97.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)propanamide?
The IUPAC name of 3-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)propanamide (CID 55219479) is 3-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)propanamide.
What is the SMILES notation for 3-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)propanamide?
The canonical SMILES for 3-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)propanamide is Cc1c(C)c(=O)n(CCC(N)=O)[nH]c1=O.
What is the InChIKey of 3-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)propanamide?
The InChIKey is AHAZUFXRUPXBIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O3/c1-5-6(2)9(15)12(11-8(5)14)4-3-7(10)13/h3-4H2,1-2H3,(H2,10,13)(H,11,14).
What are the key properties of 3-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)propanamide?
3-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)propanamide has a molecular weight of 211.22 g/mol, XLogP of -0.97, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)propanamide is sourced from PubChem (CID 55219479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).