C10H15N5O2 — CID 55219544
3-methyl-4-[3-(1,2,4-triazol-1-yl)propanoyl]piperazin-2-one (PubChem CID 55219544) has the molecular formula C10H15N5O2 and a molecular weight of 237.26 g/mol. Its IUPAC name is 3-methyl-4-[3-(1,2,4-triazol-1-yl)propanoyl]piperazin-2-one.
| Compound Name | 3-methyl-4-[3-(1,2,4-triazol-1-yl)propanoyl]piperazin-2-one |
|---|---|
| PubChem CID | 55219544 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 3-methyl-4-[3-(1,2,4-triazol-1-yl)propanoyl]piperazin-2-one |
| SMILES | CC1C(=O)NCCN1C(=O)CCn1cncn1 |
| InChI | InChI=1S/C10H15N5O2/c1-8-10(17)12-3-5-15(8)9(16)2-4-14-7-11-6-13-14/h6-8H,2-5H2,1H3,(H,12,17) |
| InChIKey | CBACTWPTLZFMQE-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |