About 6-amino-3,4-dihydro-1H-pyrimidin-2-one
6-amino-3,4-dihydro-1H-pyrimidin-2-one (PubChem CID 55219745) has the molecular formula C4H7N3O
and a molecular weight of 113.12 g/mol. Its IUPAC name is 6-amino-3,4-dihydro-1H-pyrimidin-2-one.
Molecular Properties
| Compound Name | 6-amino-3,4-dihydro-1H-pyrimidin-2-one |
| PubChem CID | 55219745 |
| Molecular Formula | C4H7N3O |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.06 |
| IUPAC Name | 6-amino-3,4-dihydro-1H-pyrimidin-2-one |
| SMILES | NC1=CCNC(=O)N1 |
| InChI | InChI=1S/C4H7N3O/c5-3-1-2-6-4(8)7-3/h1H,2,5H2,(H2,6,7,8) |
| InChIKey | SPHVNFKSCRQBIC-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-amino-3,4-dihydro-1H-pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-3,4-dihydro-1H-pyrimidin-2-one?
The IUPAC name of 6-amino-3,4-dihydro-1H-pyrimidin-2-one (CID 55219745) is 6-amino-3,4-dihydro-1H-pyrimidin-2-one.
What is the SMILES notation for 6-amino-3,4-dihydro-1H-pyrimidin-2-one?
The canonical SMILES for 6-amino-3,4-dihydro-1H-pyrimidin-2-one is NC1=CCNC(=O)N1.
What is the InChIKey of 6-amino-3,4-dihydro-1H-pyrimidin-2-one?
The InChIKey is SPHVNFKSCRQBIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3O/c5-3-1-2-6-4(8)7-3/h1H,2,5H2,(H2,6,7,8).
What are the key properties of 6-amino-3,4-dihydro-1H-pyrimidin-2-one?
6-amino-3,4-dihydro-1H-pyrimidin-2-one has a molecular weight of 113.12 g/mol, XLogP of -0.90, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3,4-dihydro-1H-pyrimidin-2-one is sourced from PubChem (CID 55219745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).