About 3-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-1-ethylpyrazin-2-one
3-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-1-ethylpyrazin-2-one (PubChem CID 55219868) has the molecular formula C13H23N5O
and a molecular weight of 265.36 g/mol. Its IUPAC name is 3-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-1-ethylpyrazin-2-one.
Molecular Properties
| Compound Name | 3-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-1-ethylpyrazin-2-one |
| PubChem CID | 55219868 |
| Molecular Formula | C13H23N5O |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | 3-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-1-ethylpyrazin-2-one |
| SMILES | CCn1ccnc(N2CCCN(CCN)CC2)c1=O |
| InChI | InChI=1S/C13H23N5O/c1-2-17-9-5-15-12(13(17)19)18-7-3-6-16(8-4-14)10-11-18/h5,9H,2-4,6-8,10-11,14H2,1H3 |
| InChIKey | ZMQFFASBGLYBBZ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 67.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-1-ethylpyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-1-ethylpyrazin-2-one?
The IUPAC name of 3-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-1-ethylpyrazin-2-one (CID 55219868) is 3-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-1-ethylpyrazin-2-one.
What is the SMILES notation for 3-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-1-ethylpyrazin-2-one?
The canonical SMILES for 3-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-1-ethylpyrazin-2-one is CCn1ccnc(N2CCCN(CCN)CC2)c1=O.
What is the InChIKey of 3-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-1-ethylpyrazin-2-one?
The InChIKey is ZMQFFASBGLYBBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N5O/c1-2-17-9-5-15-12(13(17)19)18-7-3-6-16(8-4-14)10-11-18/h5,9H,2-4,6-8,10-11,14H2,1H3.
What are the key properties of 3-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-1-ethylpyrazin-2-one?
3-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-1-ethylpyrazin-2-one has a molecular weight of 265.36 g/mol, XLogP of -0.27, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-1-ethylpyrazin-2-one is sourced from PubChem (CID 55219868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).