C16H34N2O — CID 55220646
N-[[1-(2-butoxyethyl)piperidin-3-yl]methyl]-2-methylpropan-2-amine (PubChem CID 55220646) has the molecular formula C16H34N2O and a molecular weight of 270.46 g/mol. Its IUPAC name is N-[[1-(2-butoxyethyl)piperidin-3-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[1-(2-butoxyethyl)piperidin-3-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 55220646 |
| Molecular Formula | C16H34N2O |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.27 |
| IUPAC Name | N-[[1-(2-butoxyethyl)piperidin-3-yl]methyl]-2-methylpropan-2-amine |
| SMILES | CCCCOCCN1CCCC(CNC(C)(C)C)C1 |
| InChI | InChI=1S/C16H34N2O/c1-5-6-11-19-12-10-18-9-7-8-15(14-18)13-17-16(2,3)4/h15,17H,5-14H2,1-4H3 |
| InChIKey | JKGMYBXHOSVJCQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|