C14H11BrCl2O2 — CID 55221480
(1S)-1-[3-bromo-4-(3,5-dichlorophenoxy)phenyl]ethanol (PubChem CID 55221480) has the molecular formula C14H11BrCl2O2 and a molecular weight of 362.05 g/mol. Its IUPAC name is (1S)-1-[3-bromo-4-(3,5-dichlorophenoxy)phenyl]ethanol.
| Compound Name | (1S)-1-[3-bromo-4-(3,5-dichlorophenoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 55221480 |
| Molecular Formula | C14H11BrCl2O2 |
| Molecular Weight | 362.05 g/mol |
| Exact Mass | 359.93 |
| IUPAC Name | (1S)-1-[3-bromo-4-(3,5-dichlorophenoxy)phenyl]ethanol |
| SMILES | C[C@H](O)c1ccc(Oc2cc(Cl)cc(Cl)c2)c(Br)c1 |
| InChI | InChI=1S/C14H11BrCl2O2/c1-8(18)9-2-3-14(13(15)4-9)19-12-6-10(16)5-11(17)7-12/h2-8,18H,1H3/t8-/m0/s1 |
| InChIKey | BPPSPFACLZSALO-QMMMGPOBSA-N |
| XLogP | 5.60 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.05 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |