C14H21N3S — CID 55222065
3-thiophen-2-yl-5-(2,4,4-trimethylpentyl)-1H-1,2,4-triazole (PubChem CID 55222065) has the molecular formula C14H21N3S and a molecular weight of 263.41 g/mol. Its IUPAC name is 3-thiophen-2-yl-5-(2,4,4-trimethylpentyl)-1H-1,2,4-triazole.
| Compound Name | 3-thiophen-2-yl-5-(2,4,4-trimethylpentyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 55222065 |
| Molecular Formula | C14H21N3S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 3-thiophen-2-yl-5-(2,4,4-trimethylpentyl)-1H-1,2,4-triazole |
| SMILES | CC(Cc1nc(-c2cccs2)n[nH]1)CC(C)(C)C |
| InChI | InChI=1S/C14H21N3S/c1-10(9-14(2,3)4)8-12-15-13(17-16-12)11-6-5-7-18-11/h5-7,10H,8-9H2,1-4H3,(H,15,16,17) |
| InChIKey | WHMMRLMPAZHHJB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |