About N-ethyl-5,6,8-trifluoro-3-propylquinolin-2-amine
N-ethyl-5,6,8-trifluoro-3-propylquinolin-2-amine (PubChem CID 55223170) has the molecular formula C14H15F3N2
and a molecular weight of 268.28 g/mol. Its IUPAC name is N-ethyl-5,6,8-trifluoro-3-propylquinolin-2-amine.
Molecular Properties
| Compound Name | N-ethyl-5,6,8-trifluoro-3-propylquinolin-2-amine |
| PubChem CID | 55223170 |
| Molecular Formula | C14H15F3N2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | N-ethyl-5,6,8-trifluoro-3-propylquinolin-2-amine |
| SMILES | CCCc1cc2c(F)c(F)cc(F)c2nc1NCC |
| InChI | InChI=1S/C14H15F3N2/c1-3-5-8-6-9-12(17)10(15)7-11(16)13(9)19-14(8)18-4-2/h6-7H,3-5H2,1-2H3,(H,18,19) |
| InChIKey | VBJDTPOQVWGRFY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-5,6,8-trifluoro-3-propylquinolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-5,6,8-trifluoro-3-propylquinolin-2-amine?
The IUPAC name of N-ethyl-5,6,8-trifluoro-3-propylquinolin-2-amine (CID 55223170) is N-ethyl-5,6,8-trifluoro-3-propylquinolin-2-amine.
What is the SMILES notation for N-ethyl-5,6,8-trifluoro-3-propylquinolin-2-amine?
The canonical SMILES for N-ethyl-5,6,8-trifluoro-3-propylquinolin-2-amine is CCCc1cc2c(F)c(F)cc(F)c2nc1NCC.
What is the InChIKey of N-ethyl-5,6,8-trifluoro-3-propylquinolin-2-amine?
The InChIKey is VBJDTPOQVWGRFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F3N2/c1-3-5-8-6-9-12(17)10(15)7-11(16)13(9)19-14(8)18-4-2/h6-7H,3-5H2,1-2H3,(H,18,19).
What are the key properties of N-ethyl-5,6,8-trifluoro-3-propylquinolin-2-amine?
N-ethyl-5,6,8-trifluoro-3-propylquinolin-2-amine has a molecular weight of 268.28 g/mol, XLogP of 4.04, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-5,6,8-trifluoro-3-propylquinolin-2-amine is sourced from PubChem (CID 55223170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).