C11H14N6OS — CID 55223405
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N'-hydroxy-6-methylpyridine-3-carboximidamide (PubChem CID 55223405) has the molecular formula C11H14N6OS and a molecular weight of 278.34 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N'-hydroxy-6-methylpyridine-3-carboximidamide.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N'-hydroxy-6-methylpyridine-3-carboximidamide |
|---|---|
| PubChem CID | 55223405 |
| Molecular Formula | C11H14N6OS |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N'-hydroxy-6-methylpyridine-3-carboximidamide |
| SMILES | Cc1ccc(/C(N)=N/O)c(Sc2nnc(C)n2C)n1 |
| InChI | InChI=1S/C11H14N6OS/c1-6-4-5-8(9(12)16-18)10(13-6)19-11-15-14-7(2)17(11)3/h4-5,18H,1-3H3,(H2,12,16) |
| InChIKey | BKWWXLUIFWCTPD-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|