C14H16Br2O2 — CID 55223662
10,16-dibromo-3,7-dioxatricyclo[9.5.0.02,8]hexadeca-1,8,10-triene (PubChem CID 55223662) has the molecular formula C14H16Br2O2 and a molecular weight of 376.09 g/mol. Its IUPAC name is 10,16-dibromo-3,7-dioxatricyclo[9.5.0.02,8]hexadeca-1,8,10-triene.
| Compound Name | 10,16-dibromo-3,7-dioxatricyclo[9.5.0.02,8]hexadeca-1,8,10-triene |
|---|---|
| PubChem CID | 55223662 |
| Molecular Formula | C14H16Br2O2 |
| Molecular Weight | 376.09 g/mol |
| Exact Mass | 373.95 |
| IUPAC Name | 10,16-dibromo-3,7-dioxatricyclo[9.5.0.02,8]hexadeca-1,8,10-triene |
| SMILES | Brc1cc2c(c3c1CCCCC3Br)OCCCO2 |
| InChI | InChI=1S/C14H16Br2O2/c15-10-5-2-1-4-9-11(16)8-12-14(13(9)10)18-7-3-6-17-12/h8,10H,1-7H2 |
| InChIKey | XGEJTZBOTOTRQZ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.09 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|