About 1,2,3-trimethoxypentane
1,2,3-trimethoxypentane (PubChem CID 552243) has the molecular formula C8H18O3
and a molecular weight of 162.23 g/mol. Its IUPAC name is 1,2,3-trimethoxypentane.
Molecular Properties
| Compound Name | 1,2,3-trimethoxypentane |
| PubChem CID | 552243 |
| Molecular Formula | C8H18O3 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.13 |
| IUPAC Name | 1,2,3-trimethoxypentane |
| SMILES | CCC(OC)C(COC)OC |
| InChI | InChI=1S/C8H18O3/c1-5-7(10-3)8(11-4)6-9-2/h7-8H,5-6H2,1-4H3 |
| InChIKey | HURIHJCELQOCMD-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,2,3-trimethoxypentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-trimethoxypentane?
The IUPAC name of 1,2,3-trimethoxypentane (CID 552243) is 1,2,3-trimethoxypentane.
What is the SMILES notation for 1,2,3-trimethoxypentane?
The canonical SMILES for 1,2,3-trimethoxypentane is CCC(OC)C(COC)OC.
What is the InChIKey of 1,2,3-trimethoxypentane?
The InChIKey is HURIHJCELQOCMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O3/c1-5-7(10-3)8(11-4)6-9-2/h7-8H,5-6H2,1-4H3.
What are the key properties of 1,2,3-trimethoxypentane?
1,2,3-trimethoxypentane has a molecular weight of 162.23 g/mol, XLogP of 1.07, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-trimethoxypentane is sourced from PubChem (CID 552243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).