C15H13ClF2O — CID 55224386
1-[[2-(chloromethyl)-4-methylphenoxy]methyl]-2,3-difluorobenzene (PubChem CID 55224386) has the molecular formula C15H13ClF2O and a molecular weight of 282.72 g/mol. Its IUPAC name is 1-[[2-(chloromethyl)-4-methylphenoxy]methyl]-2,3-difluorobenzene.
| Compound Name | 1-[[2-(chloromethyl)-4-methylphenoxy]methyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 55224386 |
| Molecular Formula | C15H13ClF2O |
| Molecular Weight | 282.72 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 1-[[2-(chloromethyl)-4-methylphenoxy]methyl]-2,3-difluorobenzene |
| SMILES | Cc1ccc(OCc2cccc(F)c2F)c(CCl)c1 |
| InChI | InChI=1S/C15H13ClF2O/c1-10-5-6-14(12(7-10)8-16)19-9-11-3-2-4-13(17)15(11)18/h2-7H,8-9H2,1H3 |
| InChIKey | QQYOWFAFPZRKRU-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.72 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|