C14H10BrF3 — CID 55224470
2-[1-bromo-2-(2-fluorophenyl)ethyl]-1,3-difluorobenzene (PubChem CID 55224470) has the molecular formula C14H10BrF3 and a molecular weight of 315.13 g/mol. Its IUPAC name is 2-[1-bromo-2-(2-fluorophenyl)ethyl]-1,3-difluorobenzene.
| Compound Name | 2-[1-bromo-2-(2-fluorophenyl)ethyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 55224470 |
| Molecular Formula | C14H10BrF3 |
| Molecular Weight | 315.13 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | 2-[1-bromo-2-(2-fluorophenyl)ethyl]-1,3-difluorobenzene |
| SMILES | Fc1ccccc1CC(Br)c1c(F)cccc1F |
| InChI | InChI=1S/C14H10BrF3/c15-10(8-9-4-1-2-5-11(9)16)14-12(17)6-3-7-13(14)18/h1-7,10H,8H2 |
| InChIKey | JPJTXXHGWRPYEB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.13 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|