C17H18ClF — CID 55224820
4-[1-chloro-2-(3,4-dimethylphenyl)ethyl]-2-fluoro-1-methylbenzene (PubChem CID 55224820) has the molecular formula C17H18ClF and a molecular weight of 276.78 g/mol. Its IUPAC name is 4-[1-chloro-2-(3,4-dimethylphenyl)ethyl]-2-fluoro-1-methylbenzene.
| Compound Name | 4-[1-chloro-2-(3,4-dimethylphenyl)ethyl]-2-fluoro-1-methylbenzene |
|---|---|
| PubChem CID | 55224820 |
| Molecular Formula | C17H18ClF |
| Molecular Weight | 276.78 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 4-[1-chloro-2-(3,4-dimethylphenyl)ethyl]-2-fluoro-1-methylbenzene |
| SMILES | Cc1ccc(CC(Cl)c2ccc(C)c(F)c2)cc1C |
| InChI | InChI=1S/C17H18ClF/c1-11-4-6-14(8-13(11)3)9-16(18)15-7-5-12(2)17(19)10-15/h4-8,10,16H,9H2,1-3H3 |
| InChIKey | BAGUKDPCKWUNCT-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.78 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|