C15H24N4 — CID 55225122
3-(diethylamino)-N'-phenylpyrrolidine-1-carboximidamide (PubChem CID 55225122) has the molecular formula C15H24N4 and a molecular weight of 260.38 g/mol. Its IUPAC name is 3-(diethylamino)-N'-phenylpyrrolidine-1-carboximidamide.
| Compound Name | 3-(diethylamino)-N'-phenylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 55225122 |
| Molecular Formula | C15H24N4 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 3-(diethylamino)-N'-phenylpyrrolidine-1-carboximidamide |
| SMILES | CCN(CC)C1CCN(/C(N)=N/c2ccccc2)C1 |
| InChI | InChI=1S/C15H24N4/c1-3-18(4-2)14-10-11-19(12-14)15(16)17-13-8-6-5-7-9-13/h5-9,14H,3-4,10-12H2,1-2H3,(H2,16,17) |
| InChIKey | MHQLIAOJIRWEKY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|