About 5-[(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)methylamino]piperidin-2-one
5-[(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)methylamino]piperidin-2-one (PubChem CID 55226100) has the molecular formula C13H17N5O
and a molecular weight of 259.31 g/mol. Its IUPAC name is 5-[(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)methylamino]piperidin-2-one.
Molecular Properties
| Compound Name | 5-[(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)methylamino]piperidin-2-one |
| PubChem CID | 55226100 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 5-[(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)methylamino]piperidin-2-one |
| SMILES | Cc1cc2ncc(CNC3CCC(=O)NC3)cn2n1 |
| InChI | InChI=1S/C13H17N5O/c1-9-4-12-15-6-10(8-18(12)17-9)5-14-11-2-3-13(19)16-7-11/h4,6,8,11,14H,2-3,5,7H2,1H3,(H,16,19) |
| InChIKey | ZHVHMYZOSHBOGY-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)methylamino]piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)methylamino]piperidin-2-one?
The IUPAC name of 5-[(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)methylamino]piperidin-2-one (CID 55226100) is 5-[(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)methylamino]piperidin-2-one.
What is the SMILES notation for 5-[(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)methylamino]piperidin-2-one?
The canonical SMILES for 5-[(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)methylamino]piperidin-2-one is Cc1cc2ncc(CNC3CCC(=O)NC3)cn2n1.
What is the InChIKey of 5-[(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)methylamino]piperidin-2-one?
The InChIKey is ZHVHMYZOSHBOGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N5O/c1-9-4-12-15-6-10(8-18(12)17-9)5-14-11-2-3-13(19)16-7-11/h4,6,8,11,14H,2-3,5,7H2,1H3,(H,16,19).
What are the key properties of 5-[(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)methylamino]piperidin-2-one?
5-[(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)methylamino]piperidin-2-one has a molecular weight of 259.31 g/mol, XLogP of 0.41, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)methylamino]piperidin-2-one is sourced from PubChem (CID 55226100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).