About 2-ethyl-N,2-dimethyl-N-(oxan-3-ylmethyl)-N'-propylpropane-1,3-diamine
2-ethyl-N,2-dimethyl-N-(oxan-3-ylmethyl)-N'-propylpropane-1,3-diamine (PubChem CID 55226449) has the molecular formula C16H34N2O
and a molecular weight of 270.46 g/mol. Its IUPAC name is 2-ethyl-N,2-dimethyl-N-(oxan-3-ylmethyl)-N'-propylpropane-1,3-diamine.
Molecular Properties
| Compound Name | 2-ethyl-N,2-dimethyl-N-(oxan-3-ylmethyl)-N'-propylpropane-1,3-diamine |
| PubChem CID | 55226449 |
| Molecular Formula | C16H34N2O |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.27 |
| IUPAC Name | 2-ethyl-N,2-dimethyl-N-(oxan-3-ylmethyl)-N'-propylpropane-1,3-diamine |
| SMILES | CCCNCC(C)(CC)CN(C)CC1CCCOC1 |
| InChI | InChI=1S/C16H34N2O/c1-5-9-17-13-16(3,6-2)14-18(4)11-15-8-7-10-19-12-15/h15,17H,5-14H2,1-4H3 |
| InChIKey | QWRNBKFJJCBYTR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-N,2-dimethyl-N-(oxan-3-ylmethyl)-N'-propylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N,2-dimethyl-N-(oxan-3-ylmethyl)-N'-propylpropane-1,3-diamine?
The IUPAC name of 2-ethyl-N,2-dimethyl-N-(oxan-3-ylmethyl)-N'-propylpropane-1,3-diamine (CID 55226449) is 2-ethyl-N,2-dimethyl-N-(oxan-3-ylmethyl)-N'-propylpropane-1,3-diamine.
What is the SMILES notation for 2-ethyl-N,2-dimethyl-N-(oxan-3-ylmethyl)-N'-propylpropane-1,3-diamine?
The canonical SMILES for 2-ethyl-N,2-dimethyl-N-(oxan-3-ylmethyl)-N'-propylpropane-1,3-diamine is CCCNCC(C)(CC)CN(C)CC1CCCOC1.
What is the InChIKey of 2-ethyl-N,2-dimethyl-N-(oxan-3-ylmethyl)-N'-propylpropane-1,3-diamine?
The InChIKey is QWRNBKFJJCBYTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34N2O/c1-5-9-17-13-16(3,6-2)14-18(4)11-15-8-7-10-19-12-15/h15,17H,5-14H2,1-4H3.
What are the key properties of 2-ethyl-N,2-dimethyl-N-(oxan-3-ylmethyl)-N'-propylpropane-1,3-diamine?
2-ethyl-N,2-dimethyl-N-(oxan-3-ylmethyl)-N'-propylpropane-1,3-diamine has a molecular weight of 270.46 g/mol, XLogP of 2.76, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N,2-dimethyl-N-(oxan-3-ylmethyl)-N'-propylpropane-1,3-diamine is sourced from PubChem (CID 55226449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).