C12H22ClN3S — CID 55226961
N'-[1-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-N,N,N'-trimethylpropane-1,3-diamine (PubChem CID 55226961) has the molecular formula C12H22ClN3S and a molecular weight of 275.85 g/mol. Its IUPAC name is N'-[1-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-N,N,N'-trimethylpropane-1,3-diamine.
| Compound Name | N'-[1-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-N,N,N'-trimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 55226961 |
| Molecular Formula | C12H22ClN3S |
| Molecular Weight | 275.85 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | N'-[1-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-N,N,N'-trimethylpropane-1,3-diamine |
| SMILES | CC(c1nc(CCl)cs1)N(C)CCCN(C)C |
| InChI | InChI=1S/C12H22ClN3S/c1-10(12-14-11(8-13)9-17-12)16(4)7-5-6-15(2)3/h9-10H,5-8H2,1-4H3 |
| InChIKey | PTEZCDAFPQQLHY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.85 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|