C11H20Si — CID 552276
trimethyl-(2,3,3-trimethylcyclopenta-1,4-dien-1-yl)silane (PubChem CID 552276) has the molecular formula C11H20Si and a molecular weight of 180.37 g/mol. Its IUPAC name is trimethyl-(2,3,3-trimethylcyclopenta-1,4-dien-1-yl)silane.
| Compound Name | trimethyl-(2,3,3-trimethylcyclopenta-1,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 552276 |
| Molecular Formula | C11H20Si |
| Molecular Weight | 180.37 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | trimethyl-(2,3,3-trimethylcyclopenta-1,4-dien-1-yl)silane |
| SMILES | CC1=C([Si](C)(C)C)C=CC1(C)C |
| InChI | InChI=1S/C11H20Si/c1-9-10(12(4,5)6)7-8-11(9,2)3/h7-8H,1-6H3 |
| InChIKey | PSQIUDSCVQRSRN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|