About 3-N-methyl-3-N-(oxan-3-ylmethyl)-1,1-dioxothiolane-3,4-diamine
3-N-methyl-3-N-(oxan-3-ylmethyl)-1,1-dioxothiolane-3,4-diamine (PubChem CID 55227971) has the molecular formula C11H22N2O3S
and a molecular weight of 262.37 g/mol. Its IUPAC name is 3-N-methyl-3-N-(oxan-3-ylmethyl)-1,1-dioxothiolane-3,4-diamine.
Molecular Properties
| Compound Name | 3-N-methyl-3-N-(oxan-3-ylmethyl)-1,1-dioxothiolane-3,4-diamine |
| PubChem CID | 55227971 |
| Molecular Formula | C11H22N2O3S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 3-N-methyl-3-N-(oxan-3-ylmethyl)-1,1-dioxothiolane-3,4-diamine |
| SMILES | CN(CC1CCCOC1)C1CS(=O)(=O)CC1N |
| InChI | InChI=1S/C11H22N2O3S/c1-13(5-9-3-2-4-16-6-9)11-8-17(14,15)7-10(11)12/h9-11H,2-8,12H2,1H3 |
| InChIKey | IMKHOIBBISCOJK-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-N-methyl-3-N-(oxan-3-ylmethyl)-1,1-dioxothiolane-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-methyl-3-N-(oxan-3-ylmethyl)-1,1-dioxothiolane-3,4-diamine?
The IUPAC name of 3-N-methyl-3-N-(oxan-3-ylmethyl)-1,1-dioxothiolane-3,4-diamine (CID 55227971) is 3-N-methyl-3-N-(oxan-3-ylmethyl)-1,1-dioxothiolane-3,4-diamine.
What is the SMILES notation for 3-N-methyl-3-N-(oxan-3-ylmethyl)-1,1-dioxothiolane-3,4-diamine?
The canonical SMILES for 3-N-methyl-3-N-(oxan-3-ylmethyl)-1,1-dioxothiolane-3,4-diamine is CN(CC1CCCOC1)C1CS(=O)(=O)CC1N.
What is the InChIKey of 3-N-methyl-3-N-(oxan-3-ylmethyl)-1,1-dioxothiolane-3,4-diamine?
The InChIKey is IMKHOIBBISCOJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O3S/c1-13(5-9-3-2-4-16-6-9)11-8-17(14,15)7-10(11)12/h9-11H,2-8,12H2,1H3.
What are the key properties of 3-N-methyl-3-N-(oxan-3-ylmethyl)-1,1-dioxothiolane-3,4-diamine?
3-N-methyl-3-N-(oxan-3-ylmethyl)-1,1-dioxothiolane-3,4-diamine has a molecular weight of 262.37 g/mol, XLogP of -0.53, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-methyl-3-N-(oxan-3-ylmethyl)-1,1-dioxothiolane-3,4-diamine is sourced from PubChem (CID 55227971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).