About [3,7,8-trimethyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine
[3,7,8-trimethyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine (PubChem CID 55229164) has the molecular formula C13H14F3N3
and a molecular weight of 269.27 g/mol. Its IUPAC name is [3,7,8-trimethyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine.
Molecular Properties
| Compound Name | [3,7,8-trimethyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine |
| PubChem CID | 55229164 |
| Molecular Formula | C13H14F3N3 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | [3,7,8-trimethyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine |
| SMILES | Cc1ccc2c(NN)c(C)c(C(F)(F)F)nc2c1C |
| InChI | InChI=1S/C13H14F3N3/c1-6-4-5-9-10(7(6)2)18-12(13(14,15)16)8(3)11(9)19-17/h4-5H,17H2,1-3H3,(H,18,19) |
| InChIKey | DQNPEYANVQDWJC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3,7,8-trimethyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,7,8-trimethyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine?
The IUPAC name of [3,7,8-trimethyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine (CID 55229164) is [3,7,8-trimethyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine.
What is the SMILES notation for [3,7,8-trimethyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine?
The canonical SMILES for [3,7,8-trimethyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine is Cc1ccc2c(NN)c(C)c(C(F)(F)F)nc2c1C.
What is the InChIKey of [3,7,8-trimethyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine?
The InChIKey is DQNPEYANVQDWJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F3N3/c1-6-4-5-9-10(7(6)2)18-12(13(14,15)16)8(3)11(9)19-17/h4-5H,17H2,1-3H3,(H,18,19).
What are the key properties of [3,7,8-trimethyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine?
[3,7,8-trimethyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine has a molecular weight of 269.27 g/mol, XLogP of 3.46, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3,7,8-trimethyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine is sourced from PubChem (CID 55229164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).