About [6,8-dibromo-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine
[6,8-dibromo-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine (PubChem CID 55229166) has the molecular formula C11H8Br2F3N3
and a molecular weight of 399.01 g/mol. Its IUPAC name is [6,8-dibromo-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine.
Molecular Properties
| Compound Name | [6,8-dibromo-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine |
| PubChem CID | 55229166 |
| Molecular Formula | C11H8Br2F3N3 |
| Molecular Weight | 399.01 g/mol |
| Exact Mass | 396.90 |
| IUPAC Name | [6,8-dibromo-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine |
| SMILES | Cc1c(C(F)(F)F)nc2c(Br)cc(Br)cc2c1NN |
| InChI | InChI=1S/C11H8Br2F3N3/c1-4-8(19-17)6-2-5(12)3-7(13)9(6)18-10(4)11(14,15)16/h2-3H,17H2,1H3,(H,18,19) |
| InChIKey | JOVUNFYDRAGYDO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.01 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [6,8-dibromo-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6,8-dibromo-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine?
The IUPAC name of [6,8-dibromo-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine (CID 55229166) is [6,8-dibromo-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine.
What is the SMILES notation for [6,8-dibromo-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine?
The canonical SMILES for [6,8-dibromo-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine is Cc1c(C(F)(F)F)nc2c(Br)cc(Br)cc2c1NN.
What is the InChIKey of [6,8-dibromo-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine?
The InChIKey is JOVUNFYDRAGYDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8Br2F3N3/c1-4-8(19-17)6-2-5(12)3-7(13)9(6)18-10(4)11(14,15)16/h2-3H,17H2,1H3,(H,18,19).
What are the key properties of [6,8-dibromo-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine?
[6,8-dibromo-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine has a molecular weight of 399.01 g/mol, XLogP of 4.37, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [6,8-dibromo-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine is sourced from PubChem (CID 55229166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).