C11H13FN4OS2 — CID 55229364
5-(2-amino-4-fluoro-5-methoxyphenyl)sulfanyl-N,N-dimethyl-1,3,4-thiadiazol-2-amine (PubChem CID 55229364) has the molecular formula C11H13FN4OS2 and a molecular weight of 300.38 g/mol. Its IUPAC name is 5-(2-amino-4-fluoro-5-methoxyphenyl)sulfanyl-N,N-dimethyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(2-amino-4-fluoro-5-methoxyphenyl)sulfanyl-N,N-dimethyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 55229364 |
| Molecular Formula | C11H13FN4OS2 |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 5-(2-amino-4-fluoro-5-methoxyphenyl)sulfanyl-N,N-dimethyl-1,3,4-thiadiazol-2-amine |
| SMILES | COc1cc(Sc2nnc(N(C)C)s2)c(N)cc1F |
| InChI | InChI=1S/C11H13FN4OS2/c1-16(2)10-14-15-11(19-10)18-9-5-8(17-3)6(12)4-7(9)13/h4-5H,13H2,1-3H3 |
| InChIKey | NOULLOMMUDZIIT-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|