C15H25N3O — CID 55229435
5-(aminomethyl)-N,N-bis(2-methylpropyl)pyridine-2-carboxamide (PubChem CID 55229435) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is 5-(aminomethyl)-N,N-bis(2-methylpropyl)pyridine-2-carboxamide.
| Compound Name | 5-(aminomethyl)-N,N-bis(2-methylpropyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 55229435 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 5-(aminomethyl)-N,N-bis(2-methylpropyl)pyridine-2-carboxamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)c1ccc(CN)cn1 |
| InChI | InChI=1S/C15H25N3O/c1-11(2)9-18(10-12(3)4)15(19)14-6-5-13(7-16)8-17-14/h5-6,8,11-12H,7,9-10,16H2,1-4H3 |
| InChIKey | QADQJOLEMNZGAR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |