C13H15ClN4 — CID 55229872
6-chloro-5-ethyl-N-methyl-N-(pyridin-2-ylmethyl)pyrimidin-4-amine (PubChem CID 55229872) has the molecular formula C13H15ClN4 and a molecular weight of 262.74 g/mol. Its IUPAC name is 6-chloro-5-ethyl-N-methyl-N-(pyridin-2-ylmethyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-5-ethyl-N-methyl-N-(pyridin-2-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 55229872 |
| Molecular Formula | C13H15ClN4 |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 6-chloro-5-ethyl-N-methyl-N-(pyridin-2-ylmethyl)pyrimidin-4-amine |
| SMILES | CCc1c(Cl)ncnc1N(C)Cc1ccccn1 |
| InChI | InChI=1S/C13H15ClN4/c1-3-11-12(14)16-9-17-13(11)18(2)8-10-6-4-5-7-15-10/h4-7,9H,3,8H2,1-2H3 |
| InChIKey | CJBLRPZQYRNVRD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |