About 5-chloro-3,8-dimethyl-2-(trifluoromethyl)quinolin-4-amine
5-chloro-3,8-dimethyl-2-(trifluoromethyl)quinolin-4-amine (PubChem CID 55230313) has the molecular formula C12H10ClF3N2
and a molecular weight of 274.67 g/mol. Its IUPAC name is 5-chloro-3,8-dimethyl-2-(trifluoromethyl)quinolin-4-amine.
Molecular Properties
| Compound Name | 5-chloro-3,8-dimethyl-2-(trifluoromethyl)quinolin-4-amine |
| PubChem CID | 55230313 |
| Molecular Formula | C12H10ClF3N2 |
| Molecular Weight | 274.67 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 5-chloro-3,8-dimethyl-2-(trifluoromethyl)quinolin-4-amine |
| SMILES | Cc1c(C(F)(F)F)nc2c(C)ccc(Cl)c2c1N |
| InChI | InChI=1S/C12H10ClF3N2/c1-5-3-4-7(13)8-9(17)6(2)11(12(14,15)16)18-10(5)8/h3-4H,1-2H3,(H2,17,18) |
| InChIKey | SBFCGPGVPCWDEB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.67 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-chloro-3,8-dimethyl-2-(trifluoromethyl)quinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3,8-dimethyl-2-(trifluoromethyl)quinolin-4-amine?
The IUPAC name of 5-chloro-3,8-dimethyl-2-(trifluoromethyl)quinolin-4-amine (CID 55230313) is 5-chloro-3,8-dimethyl-2-(trifluoromethyl)quinolin-4-amine.
What is the SMILES notation for 5-chloro-3,8-dimethyl-2-(trifluoromethyl)quinolin-4-amine?
The canonical SMILES for 5-chloro-3,8-dimethyl-2-(trifluoromethyl)quinolin-4-amine is Cc1c(C(F)(F)F)nc2c(C)ccc(Cl)c2c1N.
What is the InChIKey of 5-chloro-3,8-dimethyl-2-(trifluoromethyl)quinolin-4-amine?
The InChIKey is SBFCGPGVPCWDEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClF3N2/c1-5-3-4-7(13)8-9(17)6(2)11(12(14,15)16)18-10(5)8/h3-4H,1-2H3,(H2,17,18).
What are the key properties of 5-chloro-3,8-dimethyl-2-(trifluoromethyl)quinolin-4-amine?
5-chloro-3,8-dimethyl-2-(trifluoromethyl)quinolin-4-amine has a molecular weight of 274.67 g/mol, XLogP of 4.11, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3,8-dimethyl-2-(trifluoromethyl)quinolin-4-amine is sourced from PubChem (CID 55230313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).