C12H10Cl3N3 — CID 55230629
6-chloro-N-(2,3-dichlorophenyl)-2,5-dimethylpyrimidin-4-amine (PubChem CID 55230629) has the molecular formula C12H10Cl3N3 and a molecular weight of 302.59 g/mol. Its IUPAC name is 6-chloro-N-(2,3-dichlorophenyl)-2,5-dimethylpyrimidin-4-amine.
| Compound Name | 6-chloro-N-(2,3-dichlorophenyl)-2,5-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 55230629 |
| Molecular Formula | C12H10Cl3N3 |
| Molecular Weight | 302.59 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | 6-chloro-N-(2,3-dichlorophenyl)-2,5-dimethylpyrimidin-4-amine |
| SMILES | Cc1nc(Cl)c(C)c(Nc2cccc(Cl)c2Cl)n1 |
| InChI | InChI=1S/C12H10Cl3N3/c1-6-11(15)16-7(2)17-12(6)18-9-5-3-4-8(13)10(9)14/h3-5H,1-2H3,(H,16,17,18) |
| InChIKey | YOASMXBKSLVEQE-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.59 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |